C21H18Cl2N2O5S — CID 17069604
N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-2,3-dimethoxybenzamide (PubChem CID 17069604) has the molecular formula C21H18Cl2N2O5S and a molecular weight of 481.36 g/mol. Its IUPAC name is N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 17069604 |
| Molecular Formula | C21H18Cl2N2O5S |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(S(=O)(=O)Nc3cc(Cl)cc(Cl)c3)cc2)c1OC |
| InChI | InChI=1S/C21H18Cl2N2O5S/c1-29-19-5-3-4-18(20(19)30-2)21(26)24-15-6-8-17(9-7-15)31(27,28)25-16-11-13(22)10-14(23)12-16/h3-12,25H,1-2H3,(H,24,26) |
| InChIKey | FFISNWSXUMCUKL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |