C21H19Cl2N3O4S2 — CID 19680002
1-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(3,4-dimethoxyphenyl)thiourea (PubChem CID 19680002) has the molecular formula C21H19Cl2N3O4S2 and a molecular weight of 512.44 g/mol. Its IUPAC name is 1-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(3,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(3,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19680002 |
| Molecular Formula | C21H19Cl2N3O4S2 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 511.02 |
| IUPAC Name | 1-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(3,4-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(S(=O)(=O)Nc3cc(Cl)cc(Cl)c3)cc2)cc1OC |
| InChI | InChI=1S/C21H19Cl2N3O4S2/c1-29-19-8-5-16(12-20(19)30-2)25-21(31)24-15-3-6-18(7-4-15)32(27,28)26-17-10-13(22)9-14(23)11-17/h3-12,26H,1-2H3,(H2,24,25,31) |
| InChIKey | PESCFJYMORQOPT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|