C21H19Cl2N3O2S2 — CID 19679998
1-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(2,5-dimethylphenyl)thiourea (PubChem CID 19679998) has the molecular formula C21H19Cl2N3O2S2 and a molecular weight of 480.44 g/mol. Its IUPAC name is 1-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(2,5-dimethylphenyl)thiourea.
| Compound Name | 1-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(2,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 19679998 |
| Molecular Formula | C21H19Cl2N3O2S2 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | 1-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(2,5-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)Nc2ccc(S(=O)(=O)Nc3cc(Cl)cc(Cl)c3)cc2)c1 |
| InChI | InChI=1S/C21H19Cl2N3O2S2/c1-13-3-4-14(2)20(9-13)25-21(29)24-17-5-7-19(8-6-17)30(27,28)26-18-11-15(22)10-16(23)12-18/h3-12,26H,1-2H3,(H2,24,25,29) |
| InChIKey | CYDLNWXCJVNHTN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|