C22H22BrN3O2S2 — CID 19678818
1-(4-bromophenyl)-3-[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]thiourea (PubChem CID 19678818) has the molecular formula C22H22BrN3O2S2 and a molecular weight of 504.48 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 19678818 |
| Molecular Formula | C22H22BrN3O2S2 |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | 1-(4-bromophenyl)-3-[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]thiourea |
| SMILES | Cc1cc(C)c(NS(=O)(=O)c2ccc(NC(=S)Nc3ccc(Br)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C22H22BrN3O2S2/c1-14-12-15(2)21(16(3)13-14)26-30(27,28)20-10-8-19(9-11-20)25-22(29)24-18-6-4-17(23)5-7-18/h4-13,26H,1-3H3,(H2,24,25,29) |
| InChIKey | JHIKVNAWGRXEQO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|