C23H21N2O5S- — CID 7068760
2-[[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoate (PubChem CID 7068760) has the molecular formula C23H21N2O5S- and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-[[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoate.
| Compound Name | 2-[[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 7068760 |
| Molecular Formula | C23H21N2O5S- |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-[[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoate |
| SMILES | Cc1cc(C)c(NS(=O)(=O)c2ccc(NC(=O)c3ccccc3C(=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C23H22N2O5S/c1-14-12-15(2)21(16(3)13-14)25-31(29,30)18-10-8-17(9-11-18)24-22(26)19-6-4-5-7-20(19)23(27)28/h4-13,25H,1-3H3,(H,24,26)(H,27,28)/p-1 |
| InChIKey | CDORHVLQFWYBJB-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |