C22H18NO3- — CID 155766667
2-[[4-[(4-methylphenyl)methyl]phenyl]carbamoyl]benzoate (PubChem CID 155766667) has the molecular formula C22H18NO3- and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-[[4-[(4-methylphenyl)methyl]phenyl]carbamoyl]benzoate.
| Compound Name | 2-[[4-[(4-methylphenyl)methyl]phenyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 155766667 |
| Molecular Formula | C22H18NO3- |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[[4-[(4-methylphenyl)methyl]phenyl]carbamoyl]benzoate |
| SMILES | Cc1ccc(Cc2ccc(NC(=O)c3ccccc3C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H19NO3/c1-15-6-8-16(9-7-15)14-17-10-12-18(13-11-17)23-21(24)19-4-2-3-5-20(19)22(25)26/h2-13H,14H2,1H3,(H,23,24)(H,25,26)/p-1 |
| InChIKey | NRSBRCRKJLDEOM-UHFFFAOYSA-M |
| XLogP | 3.20 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |