C14H11N2O3- — CID 6920825
2-[(4-methylphenyl)carbamoyl]pyridine-3-carboxylate (PubChem CID 6920825) has the molecular formula C14H11N2O3- and a molecular weight of 255.25 g/mol. Its IUPAC name is 2-[(4-methylphenyl)carbamoyl]pyridine-3-carboxylate.
| Compound Name | 2-[(4-methylphenyl)carbamoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 6920825 |
| Molecular Formula | C14H11N2O3- |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-[(4-methylphenyl)carbamoyl]pyridine-3-carboxylate |
| SMILES | Cc1ccc(NC(=O)c2ncccc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C14H12N2O3/c1-9-4-6-10(7-5-9)16-13(17)12-11(14(18)19)3-2-8-15-12/h2-8H,1H3,(H,16,17)(H,18,19)/p-1 |
| InChIKey | XKIZENVEHIYQKK-UHFFFAOYSA-M |
| XLogP | 1.01 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |