C16H13N3O — CID 70972115
N-(4-methylphenyl)-1,5-naphthyridine-2-carboxamide (PubChem CID 70972115) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(4-methylphenyl)-1,5-naphthyridine-2-carboxamide.
| Compound Name | N-(4-methylphenyl)-1,5-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 70972115 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-(4-methylphenyl)-1,5-naphthyridine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3ncccc3n2)cc1 |
| InChI | InChI=1S/C16H13N3O/c1-11-4-6-12(7-5-11)18-16(20)15-9-8-13-14(19-15)3-2-10-17-13/h2-10H,1H3,(H,18,20) |
| InChIKey | GXJTUASXTSQBCF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |