C20H18N2O3S — CID 1333349
2-methyl-N-[4-(phenylsulfamoyl)phenyl]benzamide (PubChem CID 1333349) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-methyl-N-[4-(phenylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-methyl-N-[4-(phenylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1333349 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-methyl-N-[4-(phenylsulfamoyl)phenyl]benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C20H18N2O3S/c1-15-7-5-6-10-19(15)20(23)21-16-11-13-18(14-12-16)26(24,25)22-17-8-3-2-4-9-17/h2-14,22H,1H3,(H,21,23) |
| InChIKey | AXAXMUZNFBKVRU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |