C22H22N2O3S — CID 22306495
N-[4-[(2-ethylphenyl)sulfamoyl]phenyl]-2-methylbenzamide (PubChem CID 22306495) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-[4-[(2-ethylphenyl)sulfamoyl]phenyl]-2-methylbenzamide.
| Compound Name | N-[4-[(2-ethylphenyl)sulfamoyl]phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 22306495 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[4-[(2-ethylphenyl)sulfamoyl]phenyl]-2-methylbenzamide |
| SMILES | CCc1ccccc1NS(=O)(=O)c1ccc(NC(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C22H22N2O3S/c1-3-17-9-5-7-11-21(17)24-28(26,27)19-14-12-18(13-15-19)23-22(25)20-10-6-4-8-16(20)2/h4-15,24H,3H2,1-2H3,(H,23,25) |
| InChIKey | NHJYSROYZJXHMJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |