C24H27N3O3S — CID 27229309
N-[4-(diethylamino)phenyl]-4-[(2-methylphenyl)sulfamoyl]benzamide (PubChem CID 27229309) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-4-[(2-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[4-(diethylamino)phenyl]-4-[(2-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 27229309 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-4-[(2-methylphenyl)sulfamoyl]benzamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccc(S(=O)(=O)Nc3ccccc3C)cc2)cc1 |
| InChI | InChI=1S/C24H27N3O3S/c1-4-27(5-2)21-14-12-20(13-15-21)25-24(28)19-10-16-22(17-11-19)31(29,30)26-23-9-7-6-8-18(23)3/h6-17,26H,4-5H2,1-3H3,(H,25,28) |
| InChIKey | RHPVVRFFYUFIRI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|