C21H17F3N2O4S — CID 26643217
4-[(2-methylphenyl)sulfamoyl]-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 26643217) has the molecular formula C21H17F3N2O4S and a molecular weight of 450.44 g/mol. Its IUPAC name is 4-[(2-methylphenyl)sulfamoyl]-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 4-[(2-methylphenyl)sulfamoyl]-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 26643217 |
| Molecular Formula | C21H17F3N2O4S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 4-[(2-methylphenyl)sulfamoyl]-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc(C(=O)Nc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H17F3N2O4S/c1-14-4-2-3-5-19(14)26-31(28,29)18-12-6-15(7-13-18)20(27)25-16-8-10-17(11-9-16)30-21(22,23)24/h2-13,26H,1H3,(H,25,27) |
| InChIKey | SNWCQZULQADCFF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |