C21H29N3O3S — CID 51566582
N-[4-[[(2R)-butan-2-yl]sulfamoyl]phenyl]-4-(diethylamino)benzamide (PubChem CID 51566582) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is N-[4-[[(2R)-butan-2-yl]sulfamoyl]phenyl]-4-(diethylamino)benzamide.
| Compound Name | N-[4-[[(2R)-butan-2-yl]sulfamoyl]phenyl]-4-(diethylamino)benzamide |
|---|---|
| PubChem CID | 51566582 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[4-[[(2R)-butan-2-yl]sulfamoyl]phenyl]-4-(diethylamino)benzamide |
| SMILES | CC[C@@H](C)NS(=O)(=O)c1ccc(NC(=O)c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C21H29N3O3S/c1-5-16(4)23-28(26,27)20-14-10-18(11-15-20)22-21(25)17-8-12-19(13-9-17)24(6-2)7-3/h8-16,23H,5-7H2,1-4H3,(H,22,25)/t16-/m1/s1 |
| InChIKey | MTMCYXASAVKRNG-MRXNPFEDSA-N |
| XLogP | 3.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |