C23H24N2O3S — CID 2162899
N-[4-[[(2S)-butan-2-yl]sulfamoyl]phenyl]-4-phenylbenzamide (PubChem CID 2162899) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is N-[4-[[(2S)-butan-2-yl]sulfamoyl]phenyl]-4-phenylbenzamide.
| Compound Name | N-[4-[[(2S)-butan-2-yl]sulfamoyl]phenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 2162899 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-[4-[[(2S)-butan-2-yl]sulfamoyl]phenyl]-4-phenylbenzamide |
| SMILES | CC[C@H](C)NS(=O)(=O)c1ccc(NC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O3S/c1-3-17(2)25-29(27,28)22-15-13-21(14-16-22)24-23(26)20-11-9-19(10-12-20)18-7-5-4-6-8-18/h4-17,25H,3H2,1-2H3,(H,24,26)/t17-/m0/s1 |
| InChIKey | UVWKMRLYJXECNU-KRWDZBQOSA-N |
| XLogP | 4.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |