C23H23N3O4S — CID 30379157
N,N-dimethyl-3-[[4-[(2-methylphenyl)sulfamoyl]benzoyl]amino]benzamide (PubChem CID 30379157) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is N,N-dimethyl-3-[[4-[(2-methylphenyl)sulfamoyl]benzoyl]amino]benzamide.
| Compound Name | N,N-dimethyl-3-[[4-[(2-methylphenyl)sulfamoyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 30379157 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N,N-dimethyl-3-[[4-[(2-methylphenyl)sulfamoyl]benzoyl]amino]benzamide |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc(C(=O)Nc2cccc(C(=O)N(C)C)c2)cc1 |
| InChI | InChI=1S/C23H23N3O4S/c1-16-7-4-5-10-21(16)25-31(29,30)20-13-11-17(12-14-20)22(27)24-19-9-6-8-18(15-19)23(28)26(2)3/h4-15,25H,1-3H3,(H,24,27) |
| InChIKey | IJIIJRWUZNHWEP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |