C19H21N3O4S — CID 30379406
3-[[4-(cyclopropylsulfamoyl)benzoyl]amino]-N,N-dimethylbenzamide (PubChem CID 30379406) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 3-[[4-(cyclopropylsulfamoyl)benzoyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[[4-(cyclopropylsulfamoyl)benzoyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 30379406 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 3-[[4-(cyclopropylsulfamoyl)benzoyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NC(=O)c2ccc(S(=O)(=O)NC3CC3)cc2)c1 |
| InChI | InChI=1S/C19H21N3O4S/c1-22(2)19(24)14-4-3-5-16(12-14)20-18(23)13-6-10-17(11-7-13)27(25,26)21-15-8-9-15/h3-7,10-12,15,21H,8-9H2,1-2H3,(H,20,23) |
| InChIKey | YQMPQNRQCAEMIO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |