C20H25N3O4S — CID 32627137
3-[[4-(tert-butylsulfamoyl)benzoyl]amino]-N,N-dimethylbenzamide (PubChem CID 32627137) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is 3-[[4-(tert-butylsulfamoyl)benzoyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[[4-(tert-butylsulfamoyl)benzoyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 32627137 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 3-[[4-(tert-butylsulfamoyl)benzoyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NC(=O)c2ccc(S(=O)(=O)NC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C20H25N3O4S/c1-20(2,3)22-28(26,27)17-11-9-14(10-12-17)18(24)21-16-8-6-7-15(13-16)19(25)23(4)5/h6-13,22H,1-5H3,(H,21,24) |
| InChIKey | OIWHTPOARXKCEE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |