C18H20N2O4S — CID 32626914
N,N-dimethyl-3-[[4-(methylsulfonylmethyl)benzoyl]amino]benzamide (PubChem CID 32626914) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is N,N-dimethyl-3-[[4-(methylsulfonylmethyl)benzoyl]amino]benzamide.
| Compound Name | N,N-dimethyl-3-[[4-(methylsulfonylmethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 32626914 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N,N-dimethyl-3-[[4-(methylsulfonylmethyl)benzoyl]amino]benzamide |
| SMILES | CN(C)C(=O)c1cccc(NC(=O)c2ccc(CS(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H20N2O4S/c1-20(2)18(22)15-5-4-6-16(11-15)19-17(21)14-9-7-13(8-10-14)12-25(3,23)24/h4-11H,12H2,1-3H3,(H,19,21) |
| InChIKey | PIXIQOZONNCTPV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |