C22H26N4O4 — CID 17232267
N,N'-bis[3-(dimethylcarbamoyl)phenyl]butanediamide (PubChem CID 17232267) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is N,N'-bis[3-(dimethylcarbamoyl)phenyl]butanediamide.
| Compound Name | N,N'-bis[3-(dimethylcarbamoyl)phenyl]butanediamide |
|---|---|
| PubChem CID | 17232267 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N,N'-bis[3-(dimethylcarbamoyl)phenyl]butanediamide |
| SMILES | CN(C)C(=O)c1cccc(NC(=O)CCC(=O)Nc2cccc(C(=O)N(C)C)c2)c1 |
| InChI | InChI=1S/C22H26N4O4/c1-25(2)21(29)15-7-5-9-17(13-15)23-19(27)11-12-20(28)24-18-10-6-8-16(14-18)22(30)26(3)4/h5-10,13-14H,11-12H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | HLUKMCMCEGZEGM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |