C13H20ClN3O2 — CID 119701572
3-(3-aminobutanoylamino)-N,N-dimethylbenzamide;hydrochloride (PubChem CID 119701572) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.78 g/mol. Its IUPAC name is 3-(3-aminobutanoylamino)-N,N-dimethylbenzamide;hydrochloride.
| Compound Name | 3-(3-aminobutanoylamino)-N,N-dimethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119701572 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 3-(3-aminobutanoylamino)-N,N-dimethylbenzamide;hydrochloride |
| SMILES | CC(N)CC(=O)Nc1cccc(C(=O)N(C)C)c1.Cl |
| InChI | InChI=1S/C13H19N3O2.ClH/c1-9(14)7-12(17)15-11-6-4-5-10(8-11)13(18)16(2)3;/h4-6,8-9H,7,14H2,1-3H3,(H,15,17);1H |
| InChIKey | DGJQJVODBUAMDS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |