C15H19N3O4S — CID 17232095
methyl 4-[[3-(dimethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate (PubChem CID 17232095) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is methyl 4-[[3-(dimethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate.
| Compound Name | methyl 4-[[3-(dimethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17232095 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | methyl 4-[[3-(dimethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)NC(=S)Nc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H19N3O4S/c1-18(2)14(21)10-5-4-6-11(9-10)16-15(23)17-12(19)7-8-13(20)22-3/h4-6,9H,7-8H2,1-3H3,(H2,16,17,19,23) |
| InChIKey | VKEKZZIWKNOUOX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|