C17H16ClN3O2S — CID 17232054
3-[(4-chlorobenzoyl)carbamothioylamino]-N,N-dimethylbenzamide (PubChem CID 17232054) has the molecular formula C17H16ClN3O2S and a molecular weight of 361.85 g/mol. Its IUPAC name is 3-[(4-chlorobenzoyl)carbamothioylamino]-N,N-dimethylbenzamide.
| Compound Name | 3-[(4-chlorobenzoyl)carbamothioylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 17232054 |
| Molecular Formula | C17H16ClN3O2S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 3-[(4-chlorobenzoyl)carbamothioylamino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NC(=S)NC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H16ClN3O2S/c1-21(2)16(23)12-4-3-5-14(10-12)19-17(24)20-15(22)11-6-8-13(18)9-7-11/h3-10H,1-2H3,(H2,19,20,22,24) |
| InChIKey | PPZSNWYWFWEUDL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|