C19H20BrN3O2S — CID 54791581
3-[(4-bromobenzoyl)carbamothioylamino]-N,N-diethylbenzamide (PubChem CID 54791581) has the molecular formula C19H20BrN3O2S and a molecular weight of 434.36 g/mol. Its IUPAC name is 3-[(4-bromobenzoyl)carbamothioylamino]-N,N-diethylbenzamide.
| Compound Name | 3-[(4-bromobenzoyl)carbamothioylamino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 54791581 |
| Molecular Formula | C19H20BrN3O2S |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 3-[(4-bromobenzoyl)carbamothioylamino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=S)NC(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C19H20BrN3O2S/c1-3-23(4-2)18(25)14-6-5-7-16(12-14)21-19(26)22-17(24)13-8-10-15(20)11-9-13/h5-12H,3-4H2,1-2H3,(H2,21,22,24,26) |
| InChIKey | JZOQUIDQXICRIT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|