C21H25N3O2S — CID 26164133
N,N-diethyl-3-[[2-(2-methylphenyl)acetyl]carbamothioylamino]benzamide (PubChem CID 26164133) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is N,N-diethyl-3-[[2-(2-methylphenyl)acetyl]carbamothioylamino]benzamide.
| Compound Name | N,N-diethyl-3-[[2-(2-methylphenyl)acetyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 26164133 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N,N-diethyl-3-[[2-(2-methylphenyl)acetyl]carbamothioylamino]benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=S)NC(=O)Cc2ccccc2C)c1 |
| InChI | InChI=1S/C21H25N3O2S/c1-4-24(5-2)20(26)17-11-8-12-18(13-17)22-21(27)23-19(25)14-16-10-7-6-9-15(16)3/h6-13H,4-5,14H2,1-3H3,(H2,22,23,25,27) |
| InChIKey | LORNERVSDUBCNS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|