C15H19N3O4S — CID 54777427
methyl 4-[(3-acetamido-4-methylphenyl)carbamothioylamino]-4-oxobutanoate (PubChem CID 54777427) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is methyl 4-[(3-acetamido-4-methylphenyl)carbamothioylamino]-4-oxobutanoate.
| Compound Name | methyl 4-[(3-acetamido-4-methylphenyl)carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 54777427 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | methyl 4-[(3-acetamido-4-methylphenyl)carbamothioylamino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)NC(=S)Nc1ccc(C)c(NC(C)=O)c1 |
| InChI | InChI=1S/C15H19N3O4S/c1-9-4-5-11(8-12(9)16-10(2)19)17-15(23)18-13(20)6-7-14(21)22-3/h4-5,8H,6-7H2,1-3H3,(H,16,19)(H2,17,18,20,23) |
| InChIKey | HDXQZJHYOGCDQO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|