C25H31N3O4S — CID 46761463
3-phenylpropyl 5-[[4-methyl-3-(propanoylamino)phenyl]carbamothioylamino]-5-oxopentanoate (PubChem CID 46761463) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is 3-phenylpropyl 5-[[4-methyl-3-(propanoylamino)phenyl]carbamothioylamino]-5-oxopentanoate.
| Compound Name | 3-phenylpropyl 5-[[4-methyl-3-(propanoylamino)phenyl]carbamothioylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 46761463 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 3-phenylpropyl 5-[[4-methyl-3-(propanoylamino)phenyl]carbamothioylamino]-5-oxopentanoate |
| SMILES | CCC(=O)Nc1cc(NC(=S)NC(=O)CCCC(=O)OCCCc2ccccc2)ccc1C |
| InChI | InChI=1S/C25H31N3O4S/c1-3-22(29)27-21-17-20(15-14-18(21)2)26-25(33)28-23(30)12-7-13-24(31)32-16-8-11-19-9-5-4-6-10-19/h4-6,9-10,14-15,17H,3,7-8,11-13,16H2,1-2H3,(H,27,29)(H2,26,28,30,33) |
| InChIKey | TXQFCYQQYAQILL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|