C29H32N2O4 — CID 4923883
3-phenylpropyl 5-[2-[(3,4-dimethylphenyl)carbamoyl]anilino]-5-oxopentanoate (PubChem CID 4923883) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-phenylpropyl 5-[2-[(3,4-dimethylphenyl)carbamoyl]anilino]-5-oxopentanoate.
| Compound Name | 3-phenylpropyl 5-[2-[(3,4-dimethylphenyl)carbamoyl]anilino]-5-oxopentanoate |
|---|---|
| PubChem CID | 4923883 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 3-phenylpropyl 5-[2-[(3,4-dimethylphenyl)carbamoyl]anilino]-5-oxopentanoate |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=O)CCCC(=O)OCCCc2ccccc2)cc1C |
| InChI | InChI=1S/C29H32N2O4/c1-21-17-18-24(20-22(21)2)30-29(34)25-13-6-7-14-26(25)31-27(32)15-8-16-28(33)35-19-9-12-23-10-4-3-5-11-23/h3-7,10-11,13-14,17-18,20H,8-9,12,15-16,19H2,1-2H3,(H,30,34)(H,31,32) |
| InChIKey | SVGZPDRUWZBADV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|