C19H19F3N2O3 — CID 30379466
N,N-dimethyl-3-[[4-(2,2,2-trifluoroethoxymethyl)benzoyl]amino]benzamide (PubChem CID 30379466) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is N,N-dimethyl-3-[[4-(2,2,2-trifluoroethoxymethyl)benzoyl]amino]benzamide.
| Compound Name | N,N-dimethyl-3-[[4-(2,2,2-trifluoroethoxymethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 30379466 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N,N-dimethyl-3-[[4-(2,2,2-trifluoroethoxymethyl)benzoyl]amino]benzamide |
| SMILES | CN(C)C(=O)c1cccc(NC(=O)c2ccc(COCC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H19F3N2O3/c1-24(2)18(26)15-4-3-5-16(10-15)23-17(25)14-8-6-13(7-9-14)11-27-12-19(20,21)22/h3-10H,11-12H2,1-2H3,(H,23,25) |
| InChIKey | VUXVUIGBZKRPHI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |