C17H14F6N2O2 — CID 55489667
4-(2,2,2-trifluoroethoxymethyl)-N'-[3-(trifluoromethyl)phenyl]benzohydrazide (PubChem CID 55489667) has the molecular formula C17H14F6N2O2 and a molecular weight of 392.30 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethoxymethyl)-N'-[3-(trifluoromethyl)phenyl]benzohydrazide.
| Compound Name | 4-(2,2,2-trifluoroethoxymethyl)-N'-[3-(trifluoromethyl)phenyl]benzohydrazide |
|---|---|
| PubChem CID | 55489667 |
| Molecular Formula | C17H14F6N2O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 4-(2,2,2-trifluoroethoxymethyl)-N'-[3-(trifluoromethyl)phenyl]benzohydrazide |
| SMILES | O=C(NNc1cccc(C(F)(F)F)c1)c1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F6N2O2/c18-16(19,20)10-27-9-11-4-6-12(7-5-11)15(26)25-24-14-3-1-2-13(8-14)17(21,22)23/h1-8,24H,9-10H2,(H,25,26) |
| InChIKey | FFEWBYPJCFYVGS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|