C19H19F3N2O4 — CID 55489256
N'-[2-(3-methylphenoxy)acetyl]-4-(2,2,2-trifluoroethoxymethyl)benzohydrazide (PubChem CID 55489256) has the molecular formula C19H19F3N2O4 and a molecular weight of 396.37 g/mol. Its IUPAC name is N'-[2-(3-methylphenoxy)acetyl]-4-(2,2,2-trifluoroethoxymethyl)benzohydrazide.
| Compound Name | N'-[2-(3-methylphenoxy)acetyl]-4-(2,2,2-trifluoroethoxymethyl)benzohydrazide |
|---|---|
| PubChem CID | 55489256 |
| Molecular Formula | C19H19F3N2O4 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N'-[2-(3-methylphenoxy)acetyl]-4-(2,2,2-trifluoroethoxymethyl)benzohydrazide |
| SMILES | Cc1cccc(OCC(=O)NNC(=O)c2ccc(COCC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H19F3N2O4/c1-13-3-2-4-16(9-13)28-11-17(25)23-24-18(26)15-7-5-14(6-8-15)10-27-12-19(20,21)22/h2-9H,10-12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | GTGRYLWEJQSAMG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|