C21H18F3N3O3S — CID 55516245
4-methyl-N'-[2-(3-methylphenoxy)acetyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carbohydrazide (PubChem CID 55516245) has the molecular formula C21H18F3N3O3S and a molecular weight of 449.45 g/mol. Its IUPAC name is 4-methyl-N'-[2-(3-methylphenoxy)acetyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-N'-[2-(3-methylphenoxy)acetyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 55516245 |
| Molecular Formula | C21H18F3N3O3S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 4-methyl-N'-[2-(3-methylphenoxy)acetyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1cccc(OCC(=O)NNC(=O)c2sc(-c3ccc(C(F)(F)F)cc3)nc2C)c1 |
| InChI | InChI=1S/C21H18F3N3O3S/c1-12-4-3-5-16(10-12)30-11-17(28)26-27-19(29)18-13(2)25-20(31-18)14-6-8-15(9-7-14)21(22,23)24/h3-10H,11H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | OEBYNDPTTDQQGD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|