C21H16F3N3O2S — CID 26617409
4-methyl-2-phenyl-N'-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,3-thiazole-5-carbohydrazide (PubChem CID 26617409) has the molecular formula C21H16F3N3O2S and a molecular weight of 431.44 g/mol. Its IUPAC name is 4-methyl-2-phenyl-N'-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-2-phenyl-N'-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 26617409 |
| Molecular Formula | C21H16F3N3O2S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 4-methyl-2-phenyl-N'-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=O)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16F3N3O2S/c1-13-18(30-20(25-13)15-5-3-2-4-6-15)19(29)27-26-17(28)12-9-14-7-10-16(11-8-14)21(22,23)24/h2-12H,1H3,(H,26,28)(H,27,29)/b12-9+ |
| InChIKey | KUTVUMSDTPHVMN-FMIVXFBMSA-N |
| XLogP | 4.61 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|