C21H17F2N3O3S — CID 46529259
N'-[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide (PubChem CID 46529259) has the molecular formula C21H17F2N3O3S and a molecular weight of 429.45 g/mol. Its IUPAC name is N'-[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 46529259 |
| Molecular Formula | C21H17F2N3O3S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | N'-[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=O)/C=C/c1ccccc1OC(F)F |
| InChI | InChI=1S/C21H17F2N3O3S/c1-13-18(30-20(24-13)15-8-3-2-4-9-15)19(28)26-25-17(27)12-11-14-7-5-6-10-16(14)29-21(22)23/h2-12,21H,1H3,(H,25,27)(H,26,28)/b12-11+ |
| InChIKey | UXKUIUNOMKATAY-VAWYXSNFSA-N |
| XLogP | 4.19 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|