C19H15F2N3O4S2 — CID 55454420
N'-[4-(difluoromethylsulfonyl)benzoyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide (PubChem CID 55454420) has the molecular formula C19H15F2N3O4S2 and a molecular weight of 451.48 g/mol. Its IUPAC name is N'-[4-(difluoromethylsulfonyl)benzoyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[4-(difluoromethylsulfonyl)benzoyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 55454420 |
| Molecular Formula | C19H15F2N3O4S2 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | N'-[4-(difluoromethylsulfonyl)benzoyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C19H15F2N3O4S2/c1-11-15(29-18(22-11)13-5-3-2-4-6-13)17(26)24-23-16(25)12-7-9-14(10-8-12)30(27,28)19(20)21/h2-10,19H,1H3,(H,23,25)(H,24,26) |
| InChIKey | WONMUFBGDBYLKF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|