C14H11Cl3N4O2S — CID 2797681
1-[(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)amino]-3-(1,2,2-trichloroethenyl)urea (PubChem CID 2797681) has the molecular formula C14H11Cl3N4O2S and a molecular weight of 405.69 g/mol. Its IUPAC name is 1-[(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)amino]-3-(1,2,2-trichloroethenyl)urea.
| Compound Name | 1-[(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)amino]-3-(1,2,2-trichloroethenyl)urea |
|---|---|
| PubChem CID | 2797681 |
| Molecular Formula | C14H11Cl3N4O2S |
| Molecular Weight | 405.69 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | 1-[(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)amino]-3-(1,2,2-trichloroethenyl)urea |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=O)NC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C14H11Cl3N4O2S/c1-7-9(24-13(18-7)8-5-3-2-4-6-8)12(22)20-21-14(23)19-11(17)10(15)16/h2-6H,1H3,(H,20,22)(H2,19,21,23) |
| InChIKey | UPBDVJVPKOFTCQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.69 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|