C20H20N4O2S — CID 18293182
4-methyl-N'-[2-(4-methylanilino)acetyl]-2-phenyl-1,3-thiazole-5-carbohydrazide (PubChem CID 18293182) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 4-methyl-N'-[2-(4-methylanilino)acetyl]-2-phenyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-N'-[2-(4-methylanilino)acetyl]-2-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 18293182 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 4-methyl-N'-[2-(4-methylanilino)acetyl]-2-phenyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)c2sc(-c3ccccc3)nc2C)cc1 |
| InChI | InChI=1S/C20H20N4O2S/c1-13-8-10-16(11-9-13)21-12-17(25)23-24-19(26)18-14(2)22-20(27-18)15-6-4-3-5-7-15/h3-11,21H,12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | DXKURYAQJCIDJL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|