C20H19FN4O2S — CID 55439179
2-(4-fluorophenyl)-4-methyl-N'-[2-(4-methylanilino)acetyl]-1,3-thiazole-5-carbohydrazide (PubChem CID 55439179) has the molecular formula C20H19FN4O2S and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-methyl-N'-[2-(4-methylanilino)acetyl]-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-(4-fluorophenyl)-4-methyl-N'-[2-(4-methylanilino)acetyl]-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 55439179 |
| Molecular Formula | C20H19FN4O2S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-(4-fluorophenyl)-4-methyl-N'-[2-(4-methylanilino)acetyl]-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)c2sc(-c3ccc(F)cc3)nc2C)cc1 |
| InChI | InChI=1S/C20H19FN4O2S/c1-12-3-9-16(10-4-12)22-11-17(26)24-25-19(27)18-13(2)23-20(28-18)14-5-7-15(21)8-6-14/h3-10,22H,11H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | YKORSKAYKUYQST-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|