C16H13FN4OS3 — CID 9085390
1-(4-fluorophenyl)-3-[(4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbonyl)amino]thiourea (PubChem CID 9085390) has the molecular formula C16H13FN4OS3 and a molecular weight of 392.51 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbonyl)amino]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[(4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 9085390 |
| Molecular Formula | C16H13FN4OS3 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbonyl)amino]thiourea |
| SMILES | Cc1nc(-c2ccsc2)sc1C(=O)NNC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FN4OS3/c1-9-13(25-15(18-9)10-6-7-24-8-10)14(22)20-21-16(23)19-12-4-2-11(17)3-5-12/h2-8H,1H3,(H,20,22)(H2,19,21,23) |
| InChIKey | ZLAFGKQQBPJPTI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|