C15H12N2OS2 — CID 8871070
4-methyl-N-phenyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 8871070) has the molecular formula C15H12N2OS2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 4-methyl-N-phenyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-phenyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 8871070 |
| Molecular Formula | C15H12N2OS2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 4-methyl-N-phenyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccsc2)sc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H12N2OS2/c1-10-13(14(18)17-12-5-3-2-4-6-12)20-15(16-10)11-7-8-19-9-11/h2-9H,1H3,(H,17,18) |
| InChIKey | OJCJVEQRCHKUJG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |