C18H14N2O3S — CID 51115527
3-[4-methyl-5-(phenylcarbamoyl)-1,3-thiazol-2-yl]benzoic acid (PubChem CID 51115527) has the molecular formula C18H14N2O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is 3-[4-methyl-5-(phenylcarbamoyl)-1,3-thiazol-2-yl]benzoic acid.
| Compound Name | 3-[4-methyl-5-(phenylcarbamoyl)-1,3-thiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 51115527 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 3-[4-methyl-5-(phenylcarbamoyl)-1,3-thiazol-2-yl]benzoic acid |
| SMILES | Cc1nc(-c2cccc(C(=O)O)c2)sc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H14N2O3S/c1-11-15(16(21)20-14-8-3-2-4-9-14)24-17(19-11)12-6-5-7-13(10-12)18(22)23/h2-10H,1H3,(H,20,21)(H,22,23) |
| InChIKey | WSMPTUCRSJQIEA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |