C21H16N2OS — CID 4076042
4-methyl-N-naphthalen-1-yl-2-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 4076042) has the molecular formula C21H16N2OS and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-methyl-N-naphthalen-1-yl-2-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-naphthalen-1-yl-2-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 4076042 |
| Molecular Formula | C21H16N2OS |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 4-methyl-N-naphthalen-1-yl-2-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C21H16N2OS/c1-14-19(25-21(22-14)16-9-3-2-4-10-16)20(24)23-18-13-7-11-15-8-5-6-12-17(15)18/h2-13H,1H3,(H,23,24) |
| InChIKey | NWEAQWFUCTVJDI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |