C25H20N4O3S — CID 30544350
N-[2-[[(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)amino]carbamoyl]phenyl]benzamide (PubChem CID 30544350) has the molecular formula C25H20N4O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is N-[2-[[(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)amino]carbamoyl]phenyl]benzamide.
| Compound Name | N-[2-[[(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 30544350 |
| Molecular Formula | C25H20N4O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | N-[2-[[(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)amino]carbamoyl]phenyl]benzamide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=O)c1ccccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H20N4O3S/c1-16-21(33-25(26-16)18-12-6-3-7-13-18)24(32)29-28-23(31)19-14-8-9-15-20(19)27-22(30)17-10-4-2-5-11-17/h2-15H,1H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | DRXYTNUQAVRSHG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|