C17H15N3O3S2 — CID 60620632
4-methyl-N-phenyl-2-(4-sulfamoylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 60620632) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 4-methyl-N-phenyl-2-(4-sulfamoylphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-phenyl-2-(4-sulfamoylphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 60620632 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 4-methyl-N-phenyl-2-(4-sulfamoylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccc(S(N)(=O)=O)cc2)sc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H15N3O3S2/c1-11-15(16(21)20-13-5-3-2-4-6-13)24-17(19-11)12-7-9-14(10-8-12)25(18,22)23/h2-10H,1H3,(H,20,21)(H2,18,22,23) |
| InChIKey | SSUBPDQATQTLGQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |