C18H15BrN4OS2 — CID 71518917
1-[[2-(4-bromophenyl)-4-methyl-1,3-thiazole-5-carbonyl]amino]-3-phenylthiourea (PubChem CID 71518917) has the molecular formula C18H15BrN4OS2 and a molecular weight of 447.38 g/mol. Its IUPAC name is 1-[[2-(4-bromophenyl)-4-methyl-1,3-thiazole-5-carbonyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[2-(4-bromophenyl)-4-methyl-1,3-thiazole-5-carbonyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 71518917 |
| Molecular Formula | C18H15BrN4OS2 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 445.99 |
| IUPAC Name | 1-[[2-(4-bromophenyl)-4-methyl-1,3-thiazole-5-carbonyl]amino]-3-phenylthiourea |
| SMILES | Cc1nc(-c2ccc(Br)cc2)sc1C(=O)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C18H15BrN4OS2/c1-11-15(26-17(20-11)12-7-9-13(19)10-8-12)16(24)22-23-18(25)21-14-5-3-2-4-6-14/h2-10H,1H3,(H,22,24)(H2,21,23,25) |
| InChIKey | NANSGQVFYYWNRX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|