C19H24N4OS2 — CID 8787113
1-[(1R,2R)-2-methylcyclohexyl]-3-[(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)amino]thiourea (PubChem CID 8787113) has the molecular formula C19H24N4OS2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 1-[(1R,2R)-2-methylcyclohexyl]-3-[(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)amino]thiourea.
| Compound Name | 1-[(1R,2R)-2-methylcyclohexyl]-3-[(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 8787113 |
| Molecular Formula | C19H24N4OS2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-[(1R,2R)-2-methylcyclohexyl]-3-[(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)amino]thiourea |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=S)N[C@@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C19H24N4OS2/c1-12-8-6-7-11-15(12)21-19(25)23-22-17(24)16-13(2)20-18(26-16)14-9-4-3-5-10-14/h3-5,9-10,12,15H,6-8,11H2,1-2H3,(H,22,24)(H2,21,23,25)/t12-,15-/m1/s1 |
| InChIKey | XNENMWFBPQJFNC-IUODEOHRSA-N |
| XLogP | 3.81 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|