C14H20N4OS — CID 8656598
1-[(1R,2S)-2-methylcyclohexyl]-3-(pyridine-2-carbonylamino)thiourea (PubChem CID 8656598) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 1-[(1R,2S)-2-methylcyclohexyl]-3-(pyridine-2-carbonylamino)thiourea.
| Compound Name | 1-[(1R,2S)-2-methylcyclohexyl]-3-(pyridine-2-carbonylamino)thiourea |
|---|---|
| PubChem CID | 8656598 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-[(1R,2S)-2-methylcyclohexyl]-3-(pyridine-2-carbonylamino)thiourea |
| SMILES | C[C@H]1CCCC[C@H]1NC(=S)NNC(=O)c1ccccn1 |
| InChI | InChI=1S/C14H20N4OS/c1-10-6-2-3-7-11(10)16-14(20)18-17-13(19)12-8-4-5-9-15-12/h4-5,8-11H,2-3,6-7H2,1H3,(H,17,19)(H2,16,18,20)/t10-,11+/m0/s1 |
| InChIKey | XYMYAMAYCKRPAT-WDEREUQCSA-N |
| XLogP | 1.77 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|