C16H25N5O2S2 — CID 8768628
1-[(1S,2R)-2-methylcyclohexyl]-3-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]thiourea (PubChem CID 8768628) has the molecular formula C16H25N5O2S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-[(1S,2R)-2-methylcyclohexyl]-3-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]thiourea.
| Compound Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 8768628 |
| Molecular Formula | C16H25N5O2S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]thiourea |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=S)NNC(=O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H25N5O2S2/c1-11-4-2-3-5-12(11)17-15(24)20-19-14(22)13-10-25-16(18-13)21-6-8-23-9-7-21/h10-12H,2-9H2,1H3,(H,19,22)(H2,17,20,24)/t11-,12+/m1/s1 |
| InChIKey | VPNACTHSYGSFBM-NEPJUHHUSA-N |
| XLogP | 1.67 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|