C17H22N8O5S2 — CID 24574552
1,3-bis[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]urea (PubChem CID 24574552) has the molecular formula C17H22N8O5S2 and a molecular weight of 482.55 g/mol. Its IUPAC name is 1,3-bis[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]urea.
| Compound Name | 1,3-bis[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]urea |
|---|---|
| PubChem CID | 24574552 |
| Molecular Formula | C17H22N8O5S2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 1,3-bis[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]urea |
| SMILES | O=C(NNC(=O)c1csc(N2CCOCC2)n1)NNC(=O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H22N8O5S2/c26-13(11-9-31-16(18-11)24-1-5-29-6-2-24)20-22-15(28)23-21-14(27)12-10-32-17(19-12)25-3-7-30-8-4-25/h9-10H,1-8H2,(H,20,26)(H,21,27)(H2,22,23,28) |
| InChIKey | BEYXJIGWVDFNMA-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 150.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|