C15H16ClN5O3S — CID 46672798
1-(3-chlorophenyl)-3-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]urea (PubChem CID 46672798) has the molecular formula C15H16ClN5O3S and a molecular weight of 381.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]urea |
|---|---|
| PubChem CID | 46672798 |
| Molecular Formula | C15H16ClN5O3S |
| Molecular Weight | 381.85 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]urea |
| SMILES | O=C(NNC(=O)c1csc(N2CCOCC2)n1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H16ClN5O3S/c16-10-2-1-3-11(8-10)17-14(23)20-19-13(22)12-9-25-15(18-12)21-4-6-24-7-5-21/h1-3,8-9H,4-7H2,(H,19,22)(H2,17,20,23) |
| InChIKey | CTUCVSZGOWNXAI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.85 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|