C20H25N5O3S — CID 41429984
1-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]-3-[(1-phenylcyclobutyl)methyl]urea (PubChem CID 41429984) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]-3-[(1-phenylcyclobutyl)methyl]urea.
| Compound Name | 1-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]-3-[(1-phenylcyclobutyl)methyl]urea |
|---|---|
| PubChem CID | 41429984 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]-3-[(1-phenylcyclobutyl)methyl]urea |
| SMILES | O=C(NCC1(c2ccccc2)CCC1)NNC(=O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H25N5O3S/c26-17(16-13-29-19(22-16)25-9-11-28-12-10-25)23-24-18(27)21-14-20(7-4-8-20)15-5-2-1-3-6-15/h1-3,5-6,13H,4,7-12,14H2,(H,23,26)(H2,21,24,27) |
| InChIKey | LKJDNCZBBQLBTR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|